C21H28N2O3S — CID 60553070
ethyl 2-[(2,3-dimethylbenzoyl)-pentylamino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 60553070) has the molecular formula C21H28N2O3S and a molecular weight of 388.53 g/mol. Its IUPAC name is ethyl 2-[(2,3-dimethylbenzoyl)-pentylamino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[(2,3-dimethylbenzoyl)-pentylamino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 60553070 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | ethyl 2-[(2,3-dimethylbenzoyl)-pentylamino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCCCCN(C(=O)c1cccc(C)c1C)c1nc(C)c(C(=O)OCC)s1 |
| InChI | InChI=1S/C21H28N2O3S/c1-6-8-9-13-23(19(24)17-12-10-11-14(3)15(17)4)21-22-16(5)18(27-21)20(25)26-7-2/h10-12H,6-9,13H2,1-5H3 |
| InChIKey | AKHQATBBAYINIX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|