C22H29N3O5S2 — CID 55478355
ethyl 2-[[3-(cyclopropylsulfamoyl)benzoyl]-pentylamino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 55478355) has the molecular formula C22H29N3O5S2 and a molecular weight of 479.62 g/mol. Its IUPAC name is ethyl 2-[[3-(cyclopropylsulfamoyl)benzoyl]-pentylamino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[[3-(cyclopropylsulfamoyl)benzoyl]-pentylamino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 55478355 |
| Molecular Formula | C22H29N3O5S2 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | ethyl 2-[[3-(cyclopropylsulfamoyl)benzoyl]-pentylamino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCCCCN(C(=O)c1cccc(S(=O)(=O)NC2CC2)c1)c1nc(C)c(C(=O)OCC)s1 |
| InChI | InChI=1S/C22H29N3O5S2/c1-4-6-7-13-25(22-23-15(3)19(31-22)21(27)30-5-2)20(26)16-9-8-10-18(14-16)32(28,29)24-17-11-12-17/h8-10,14,17,24H,4-7,11-13H2,1-3H3 |
| InChIKey | ZZYGKHAUTGYJQS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|