C23H33N5O5S — CID 55360312
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(cyclopropylsulfamoyl)-N-pentylbenzamide (PubChem CID 55360312) has the molecular formula C23H33N5O5S and a molecular weight of 491.61 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(cyclopropylsulfamoyl)-N-pentylbenzamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(cyclopropylsulfamoyl)-N-pentylbenzamide |
|---|---|
| PubChem CID | 55360312 |
| Molecular Formula | C23H33N5O5S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(cyclopropylsulfamoyl)-N-pentylbenzamide |
| SMILES | CCCCCN(C(=O)c1cccc(S(=O)(=O)NC2CC2)c1)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H33N5O5S/c1-3-5-7-14-27(19-20(24)28(13-6-4-2)23(31)25-21(19)29)22(30)16-9-8-10-18(15-16)34(32,33)26-17-11-12-17/h8-10,15,17,26H,3-7,11-14,24H2,1-2H3,(H,25,29,31) |
| InChIKey | WNFLSMKWPJNACQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 147.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|