C22H30N6O5 — CID 25102359
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-4-(cyclopropylamino)-3-nitrobenzamide (PubChem CID 25102359) has the molecular formula C22H30N6O5 and a molecular weight of 458.52 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-4-(cyclopropylamino)-3-nitrobenzamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-4-(cyclopropylamino)-3-nitrobenzamide |
|---|---|
| PubChem CID | 25102359 |
| Molecular Formula | C22H30N6O5 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-4-(cyclopropylamino)-3-nitrobenzamide |
| SMILES | CCCCN(C(=O)c1ccc(NC2CC2)c([N+](=O)[O-])c1)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H30N6O5/c1-3-5-11-26(18-19(23)27(12-6-4-2)22(31)25-20(18)29)21(30)14-7-10-16(24-15-8-9-15)17(13-14)28(32)33/h7,10,13,15,24H,3-6,8-9,11-12,23H2,1-2H3,(H,25,29,31) |
| InChIKey | KVRPCKOOZSFEOW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 156.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|