C20H27N5O6 — CID 26211500
N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-butyl-4-methoxy-3-nitrobenzamide (PubChem CID 26211500) has the molecular formula C20H27N5O6 and a molecular weight of 433.47 g/mol. Its IUPAC name is N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-butyl-4-methoxy-3-nitrobenzamide.
| Compound Name | N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-butyl-4-methoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 26211500 |
| Molecular Formula | C20H27N5O6 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-butyl-4-methoxy-3-nitrobenzamide |
| SMILES | CCCCN(C(=O)c1ccc(OC)c([N+](=O)[O-])c1)c1c(N)n(CC(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H27N5O6/c1-5-6-9-23(16-17(21)24(11-12(2)3)20(28)22-18(16)26)19(27)13-7-8-15(31-4)14(10-13)25(29)30/h7-8,10,12H,5-6,9,11,21H2,1-4H3,(H,22,26,28) |
| InChIKey | PXEWXEZMXXICLM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 153.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|