C19H25N5O5 — CID 29298909
N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-(2-methylpropyl)-4-nitrobenzamide (PubChem CID 29298909) has the molecular formula C19H25N5O5 and a molecular weight of 403.44 g/mol. Its IUPAC name is N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-(2-methylpropyl)-4-nitrobenzamide.
| Compound Name | N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-(2-methylpropyl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 29298909 |
| Molecular Formula | C19H25N5O5 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-(2-methylpropyl)-4-nitrobenzamide |
| SMILES | CC(C)CN(C(=O)c1ccc([N+](=O)[O-])cc1)c1c(N)n(CC(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H25N5O5/c1-11(2)9-22(18(26)13-5-7-14(8-6-13)24(28)29)15-16(20)23(10-12(3)4)19(27)21-17(15)25/h5-8,11-12H,9-10,20H2,1-4H3,(H,21,25,27) |
| InChIKey | NRILGTNURHVLHM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 144.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|