C19H24ClN5O5 — CID 29298871
N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-4-chloro-N-(2-methylpropyl)-3-nitrobenzamide (PubChem CID 29298871) has the molecular formula C19H24ClN5O5 and a molecular weight of 437.88 g/mol. Its IUPAC name is N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-4-chloro-N-(2-methylpropyl)-3-nitrobenzamide.
| Compound Name | N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-4-chloro-N-(2-methylpropyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 29298871 |
| Molecular Formula | C19H24ClN5O5 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-4-chloro-N-(2-methylpropyl)-3-nitrobenzamide |
| SMILES | CC(C)CN(C(=O)c1ccc(Cl)c([N+](=O)[O-])c1)c1c(N)n(CC(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H24ClN5O5/c1-10(2)8-23(18(27)12-5-6-13(20)14(7-12)25(29)30)15-16(21)24(9-11(3)4)19(28)22-17(15)26/h5-7,10-11H,8-9,21H2,1-4H3,(H,22,26,28) |
| InChIKey | AZLSIWUDORJBGV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 144.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|