C17H20ClN5O6 — CID 4847773
N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-4-chloro-N-(2-methoxyethyl)-3-nitrobenzamide (PubChem CID 4847773) has the molecular formula C17H20ClN5O6 and a molecular weight of 425.83 g/mol. Its IUPAC name is N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-4-chloro-N-(2-methoxyethyl)-3-nitrobenzamide.
| Compound Name | N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-4-chloro-N-(2-methoxyethyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 4847773 |
| Molecular Formula | C17H20ClN5O6 |
| Molecular Weight | 425.83 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-4-chloro-N-(2-methoxyethyl)-3-nitrobenzamide |
| SMILES | CCCn1c(N)c(N(CCOC)C(=O)c2ccc(Cl)c([N+](=O)[O-])c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H20ClN5O6/c1-3-6-22-14(19)13(15(24)20-17(22)26)21(7-8-29-2)16(25)10-4-5-11(18)12(9-10)23(27)28/h4-5,9H,3,6-8,19H2,1-2H3,(H,20,24,26) |
| InChIKey | ZDNAMYKNMFAAKO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 153.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.83 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|