C22H23N5O6 — CID 26118483
N-[6-amino-1-(2-methoxyethyl)-2,4-dioxopyrimidin-5-yl]-N-benzyl-4-methyl-3-nitrobenzamide (PubChem CID 26118483) has the molecular formula C22H23N5O6 and a molecular weight of 453.46 g/mol. Its IUPAC name is N-[6-amino-1-(2-methoxyethyl)-2,4-dioxopyrimidin-5-yl]-N-benzyl-4-methyl-3-nitrobenzamide.
| Compound Name | N-[6-amino-1-(2-methoxyethyl)-2,4-dioxopyrimidin-5-yl]-N-benzyl-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 26118483 |
| Molecular Formula | C22H23N5O6 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | N-[6-amino-1-(2-methoxyethyl)-2,4-dioxopyrimidin-5-yl]-N-benzyl-4-methyl-3-nitrobenzamide |
| SMILES | COCCn1c(N)c(N(Cc2ccccc2)C(=O)c2ccc(C)c([N+](=O)[O-])c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H23N5O6/c1-14-8-9-16(12-17(14)27(31)32)21(29)26(13-15-6-4-3-5-7-15)18-19(23)25(10-11-33-2)22(30)24-20(18)28/h3-9,12H,10-11,13,23H2,1-2H3,(H,24,28,30) |
| InChIKey | UNONTWLNAITUMD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 153.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|