C18H20Cl2N4O4 — CID 42906790
N-[6-amino-1-(2-methoxyethyl)-2,4-dioxopyrimidin-5-yl]-N-benzyl-2,2-dichlorocyclopropane-1-carboxamide (PubChem CID 42906790) has the molecular formula C18H20Cl2N4O4 and a molecular weight of 427.29 g/mol. Its IUPAC name is N-[6-amino-1-(2-methoxyethyl)-2,4-dioxopyrimidin-5-yl]-N-benzyl-2,2-dichlorocyclopropane-1-carboxamide.
| Compound Name | N-[6-amino-1-(2-methoxyethyl)-2,4-dioxopyrimidin-5-yl]-N-benzyl-2,2-dichlorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 42906790 |
| Molecular Formula | C18H20Cl2N4O4 |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | N-[6-amino-1-(2-methoxyethyl)-2,4-dioxopyrimidin-5-yl]-N-benzyl-2,2-dichlorocyclopropane-1-carboxamide |
| SMILES | COCCn1c(N)c(N(Cc2ccccc2)C(=O)C2CC2(Cl)Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H20Cl2N4O4/c1-28-8-7-23-14(21)13(15(25)22-17(23)27)24(10-11-5-3-2-4-6-11)16(26)12-9-18(12,19)20/h2-6,12H,7-10,21H2,1H3,(H,22,25,27) |
| InChIKey | ZBASVHYDARRWLZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|