C20H24Cl2N4O3 — CID 31302792
(1S)-N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2,2-dichloro-N-(3-methylbutyl)cyclopropane-1-carboxamide (PubChem CID 31302792) has the molecular formula C20H24Cl2N4O3 and a molecular weight of 439.34 g/mol. Its IUPAC name is (1S)-N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2,2-dichloro-N-(3-methylbutyl)cyclopropane-1-carboxamide.
| Compound Name | (1S)-N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2,2-dichloro-N-(3-methylbutyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 31302792 |
| Molecular Formula | C20H24Cl2N4O3 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | (1S)-N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2,2-dichloro-N-(3-methylbutyl)cyclopropane-1-carboxamide |
| SMILES | CC(C)CCN(C(=O)[C@@H]1CC1(Cl)Cl)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H24Cl2N4O3/c1-12(2)8-9-25(18(28)14-10-20(14,21)22)15-16(23)26(19(29)24-17(15)27)11-13-6-4-3-5-7-13/h3-7,12,14H,8-11,23H2,1-2H3,(H,24,27,29)/t14-/m0/s1 |
| InChIKey | RUDWPJVAQFPKHR-AWEZNQCLSA-N |
| XLogP | 2.74 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|