C23H24N4O4 — CID 7998169
(E)-N-[6-amino-1-(2-methoxyethyl)-2,4-dioxopyrimidin-5-yl]-N-benzyl-3-phenylprop-2-enamide (PubChem CID 7998169) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is (E)-N-[6-amino-1-(2-methoxyethyl)-2,4-dioxopyrimidin-5-yl]-N-benzyl-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[6-amino-1-(2-methoxyethyl)-2,4-dioxopyrimidin-5-yl]-N-benzyl-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 7998169 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | (E)-N-[6-amino-1-(2-methoxyethyl)-2,4-dioxopyrimidin-5-yl]-N-benzyl-3-phenylprop-2-enamide |
| SMILES | COCCn1c(N)c(N(Cc2ccccc2)C(=O)/C=C/c2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H24N4O4/c1-31-15-14-26-21(24)20(22(29)25-23(26)30)27(16-18-10-6-3-7-11-18)19(28)13-12-17-8-4-2-5-9-17/h2-13H,14-16,24H2,1H3,(H,25,29,30)/b13-12+ |
| InChIKey | WTMIADWGMNZDRB-OUKQBFOZSA-N |
| XLogP | 2.01 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|