C21H21N5O6 — CID 4847794
N-[6-amino-1-(2-methoxyethyl)-2,4-dioxopyrimidin-5-yl]-N-benzyl-3-nitrobenzamide (PubChem CID 4847794) has the molecular formula C21H21N5O6 and a molecular weight of 439.43 g/mol. Its IUPAC name is N-[6-amino-1-(2-methoxyethyl)-2,4-dioxopyrimidin-5-yl]-N-benzyl-3-nitrobenzamide.
| Compound Name | N-[6-amino-1-(2-methoxyethyl)-2,4-dioxopyrimidin-5-yl]-N-benzyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 4847794 |
| Molecular Formula | C21H21N5O6 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | N-[6-amino-1-(2-methoxyethyl)-2,4-dioxopyrimidin-5-yl]-N-benzyl-3-nitrobenzamide |
| SMILES | COCCn1c(N)c(N(Cc2ccccc2)C(=O)c2cccc([N+](=O)[O-])c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H21N5O6/c1-32-11-10-24-18(22)17(19(27)23-21(24)29)25(13-14-6-3-2-4-7-14)20(28)15-8-5-9-16(12-15)26(30)31/h2-9,12H,10-11,13,22H2,1H3,(H,23,27,29) |
| InChIKey | CYJXYNKMRCMOSO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 153.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|