C18H22ClN5O6 — CID 18274242
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-2-chloro-N-(2-methoxyethyl)-5-nitrobenzamide (PubChem CID 18274242) has the molecular formula C18H22ClN5O6 and a molecular weight of 439.86 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-2-chloro-N-(2-methoxyethyl)-5-nitrobenzamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-2-chloro-N-(2-methoxyethyl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 18274242 |
| Molecular Formula | C18H22ClN5O6 |
| Molecular Weight | 439.86 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-2-chloro-N-(2-methoxyethyl)-5-nitrobenzamide |
| SMILES | CCCCn1c(N)c(N(CCOC)C(=O)c2cc([N+](=O)[O-])ccc2Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H22ClN5O6/c1-3-4-7-23-15(20)14(16(25)21-18(23)27)22(8-9-30-2)17(26)12-10-11(24(28)29)5-6-13(12)19/h5-6,10H,3-4,7-9,20H2,1-2H3,(H,21,25,27) |
| InChIKey | QQCQSFLTZRTANG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 153.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.86 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|