C20H25ClN4O4 — CID 26186042
(E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(4-chlorophenyl)-N-(2-methoxyethyl)prop-2-enamide (PubChem CID 26186042) has the molecular formula C20H25ClN4O4 and a molecular weight of 420.90 g/mol. Its IUPAC name is (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(4-chlorophenyl)-N-(2-methoxyethyl)prop-2-enamide.
| Compound Name | (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(4-chlorophenyl)-N-(2-methoxyethyl)prop-2-enamide |
|---|---|
| PubChem CID | 26186042 |
| Molecular Formula | C20H25ClN4O4 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(4-chlorophenyl)-N-(2-methoxyethyl)prop-2-enamide |
| SMILES | CCCCn1c(N)c(N(CCOC)C(=O)/C=C/c2ccc(Cl)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H25ClN4O4/c1-3-4-11-25-18(22)17(19(27)23-20(25)28)24(12-13-29-2)16(26)10-7-14-5-8-15(21)9-6-14/h5-10H,3-4,11-13,22H2,1-2H3,(H,23,27,28)/b10-7+ |
| InChIKey | CPGZYRPYJZVFRP-JXMROGBWSA-N |
| XLogP | 2.27 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|