C25H27ClN4O4 — CID 31494741
(E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(3-chlorophenyl)-N-[(2-methoxyphenyl)methyl]prop-2-enamide (PubChem CID 31494741) has the molecular formula C25H27ClN4O4 and a molecular weight of 482.97 g/mol. Its IUPAC name is (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(3-chlorophenyl)-N-[(2-methoxyphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(3-chlorophenyl)-N-[(2-methoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 31494741 |
| Molecular Formula | C25H27ClN4O4 |
| Molecular Weight | 482.97 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(3-chlorophenyl)-N-[(2-methoxyphenyl)methyl]prop-2-enamide |
| SMILES | CCCCn1c(N)c(N(Cc2ccccc2OC)C(=O)/C=C/c2cccc(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H27ClN4O4/c1-3-4-14-29-23(27)22(24(32)28-25(29)33)30(16-18-9-5-6-11-20(18)34-2)21(31)13-12-17-8-7-10-19(26)15-17/h5-13,15H,3-4,14,16,27H2,1-2H3,(H,28,32,33)/b13-12+ |
| InChIKey | MEDYCCFNUNGYDQ-OUKQBFOZSA-N |
| XLogP | 3.83 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.97 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|