C21H27ClN4O3 — CID 29441374
(E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-3-(3-chlorophenyl)prop-2-enamide (PubChem CID 29441374) has the molecular formula C21H27ClN4O3 and a molecular weight of 418.93 g/mol. Its IUPAC name is (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-3-(3-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-3-(3-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 29441374 |
| Molecular Formula | C21H27ClN4O3 |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butyl-3-(3-chlorophenyl)prop-2-enamide |
| SMILES | CCCCN(C(=O)/C=C/c1cccc(Cl)c1)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H27ClN4O3/c1-3-5-12-25(17(27)11-10-15-8-7-9-16(22)14-15)18-19(23)26(13-6-4-2)21(29)24-20(18)28/h7-11,14H,3-6,12-13,23H2,1-2H3,(H,24,28,29)/b11-10+ |
| InChIKey | BFPVHHXKNKGFDW-ZHACJKMWSA-N |
| XLogP | 3.42 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|