C19H22Cl2N4O3 — CID 30252338
(E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(2,3-dichlorophenyl)-N-ethylprop-2-enamide (PubChem CID 30252338) has the molecular formula C19H22Cl2N4O3 and a molecular weight of 425.32 g/mol. Its IUPAC name is (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(2,3-dichlorophenyl)-N-ethylprop-2-enamide.
| Compound Name | (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(2,3-dichlorophenyl)-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 30252338 |
| Molecular Formula | C19H22Cl2N4O3 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(2,3-dichlorophenyl)-N-ethylprop-2-enamide |
| SMILES | CCCCn1c(N)c(N(CC)C(=O)/C=C/c2cccc(Cl)c2Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H22Cl2N4O3/c1-3-5-11-25-17(22)16(18(27)23-19(25)28)24(4-2)14(26)10-9-12-7-6-8-13(20)15(12)21/h6-10H,3-5,11,22H2,1-2H3,(H,23,27,28)/b10-9+ |
| InChIKey | SEERIHFGXHFQJS-MDZDMXLPSA-N |
| XLogP | 3.29 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|