C21H26F2N4O4 — CID 16594296
(E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-[2-(difluoromethoxy)phenyl]-N-propylprop-2-enamide (PubChem CID 16594296) has the molecular formula C21H26F2N4O4 and a molecular weight of 436.46 g/mol. Its IUPAC name is (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-[2-(difluoromethoxy)phenyl]-N-propylprop-2-enamide.
| Compound Name | (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-[2-(difluoromethoxy)phenyl]-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 16594296 |
| Molecular Formula | C21H26F2N4O4 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-[2-(difluoromethoxy)phenyl]-N-propylprop-2-enamide |
| SMILES | CCCCn1c(N)c(N(CCC)C(=O)/C=C/c2ccccc2OC(F)F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H26F2N4O4/c1-3-5-13-27-18(24)17(19(29)25-21(27)30)26(12-4-2)16(28)11-10-14-8-6-7-9-15(14)31-20(22)23/h6-11,20H,3-5,12-13,24H2,1-2H3,(H,25,29,30)/b11-10+ |
| InChIKey | WQUBSDBRYYLNDI-ZHACJKMWSA-N |
| XLogP | 2.98 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|