C21H27FN4O5 — CID 34052379
(E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(3-fluoro-4-methoxyphenyl)-N-(2-methoxyethyl)prop-2-enamide (PubChem CID 34052379) has the molecular formula C21H27FN4O5 and a molecular weight of 434.47 g/mol. Its IUPAC name is (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(3-fluoro-4-methoxyphenyl)-N-(2-methoxyethyl)prop-2-enamide.
| Compound Name | (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(3-fluoro-4-methoxyphenyl)-N-(2-methoxyethyl)prop-2-enamide |
|---|---|
| PubChem CID | 34052379 |
| Molecular Formula | C21H27FN4O5 |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(3-fluoro-4-methoxyphenyl)-N-(2-methoxyethyl)prop-2-enamide |
| SMILES | CCCCn1c(N)c(N(CCOC)C(=O)/C=C/c2ccc(OC)c(F)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H27FN4O5/c1-4-5-10-26-19(23)18(20(28)24-21(26)29)25(11-12-30-2)17(27)9-7-14-6-8-16(31-3)15(22)13-14/h6-9,13H,4-5,10-12,23H2,1-3H3,(H,24,28,29)/b9-7+ |
| InChIKey | JVBBXHJWMLCKGZ-VQHVLOKHSA-N |
| XLogP | 1.76 |
| TPSA | 119.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|