C24H34N4O6 — CID 55344818
(E)-N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-3-(4-butoxy-3-methoxyphenyl)-N-(2-methoxyethyl)prop-2-enamide (PubChem CID 55344818) has the molecular formula C24H34N4O6 and a molecular weight of 474.56 g/mol. Its IUPAC name is (E)-N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-3-(4-butoxy-3-methoxyphenyl)-N-(2-methoxyethyl)prop-2-enamide.
| Compound Name | (E)-N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-3-(4-butoxy-3-methoxyphenyl)-N-(2-methoxyethyl)prop-2-enamide |
|---|---|
| PubChem CID | 55344818 |
| Molecular Formula | C24H34N4O6 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | (E)-N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-3-(4-butoxy-3-methoxyphenyl)-N-(2-methoxyethyl)prop-2-enamide |
| SMILES | CCCCOc1ccc(/C=C/C(=O)N(CCOC)c2c(N)n(CCC)c(=O)[nH]c2=O)cc1OC |
| InChI | InChI=1S/C24H34N4O6/c1-5-7-14-34-18-10-8-17(16-19(18)33-4)9-11-20(29)27(13-15-32-3)21-22(25)28(12-6-2)24(31)26-23(21)30/h8-11,16H,5-7,12-15,25H2,1-4H3,(H,26,30,31)/b11-9+ |
| InChIKey | LTNYOCRDSVKKGB-PKNBQFBNSA-N |
| XLogP | 2.41 |
| TPSA | 128.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|