C17H22N4O5 — CID 6215046
(E)-N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-3-(furan-2-yl)-N-(2-methoxyethyl)prop-2-enamide (PubChem CID 6215046) has the molecular formula C17H22N4O5 and a molecular weight of 362.39 g/mol. Its IUPAC name is (E)-N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-3-(furan-2-yl)-N-(2-methoxyethyl)prop-2-enamide.
| Compound Name | (E)-N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-3-(furan-2-yl)-N-(2-methoxyethyl)prop-2-enamide |
|---|---|
| PubChem CID | 6215046 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | (E)-N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-3-(furan-2-yl)-N-(2-methoxyethyl)prop-2-enamide |
| SMILES | CCCn1c(N)c(N(CCOC)C(=O)/C=C/c2ccco2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H22N4O5/c1-3-8-21-15(18)14(16(23)19-17(21)24)20(9-11-25-2)13(22)7-6-12-5-4-10-26-12/h4-7,10H,3,8-9,11,18H2,1-2H3,(H,19,23,24)/b7-6+ |
| InChIKey | IENQZKIWGPSTBW-VOTSOKGWSA-N |
| XLogP | 0.81 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|