C22H22Cl2N4O3 — CID 26186362
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-benzyl-2,3-dichlorobenzamide (PubChem CID 26186362) has the molecular formula C22H22Cl2N4O3 and a molecular weight of 461.35 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-benzyl-2,3-dichlorobenzamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-benzyl-2,3-dichlorobenzamide |
|---|---|
| PubChem CID | 26186362 |
| Molecular Formula | C22H22Cl2N4O3 |
| Molecular Weight | 461.35 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-benzyl-2,3-dichlorobenzamide |
| SMILES | CCCCn1c(N)c(N(Cc2ccccc2)C(=O)c2cccc(Cl)c2Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H22Cl2N4O3/c1-2-3-12-27-19(25)18(20(29)26-22(27)31)28(13-14-8-5-4-6-9-14)21(30)15-10-7-11-16(23)17(15)24/h4-11H,2-3,12-13,25H2,1H3,(H,26,29,31) |
| InChIKey | OCVNCEWNOMOVHV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.35 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |