C20H31N6O2S+ — CID 9093764
2-[[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-benzylcarbamothioyl]amino]ethyl-dimethylazanium (PubChem CID 9093764) has the molecular formula C20H31N6O2S+ and a molecular weight of 419.58 g/mol. Its IUPAC name is 2-[[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-benzylcarbamothioyl]amino]ethyl-dimethylazanium.
| Compound Name | 2-[[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-benzylcarbamothioyl]amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 9093764 |
| Molecular Formula | C20H31N6O2S+ |
| Molecular Weight | 419.58 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 2-[[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-benzylcarbamothioyl]amino]ethyl-dimethylazanium |
| SMILES | CCCCn1c(N)c(N(Cc2ccccc2)C(=S)NCC[NH+](C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H30N6O2S/c1-4-5-12-25-17(21)16(18(27)23-19(25)28)26(14-15-9-7-6-8-10-15)20(29)22-11-13-24(2)3/h6-10H,4-5,11-14,21H2,1-3H3,(H,22,29)(H,23,27,28)/p+1 |
| InChIKey | ATNWYJGYZCDIIZ-UHFFFAOYSA-O |
| XLogP | -0.06 |
| TPSA | 100.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.58 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|