C20H22N4O4 — CID 18084185
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-benzylfuran-2-carboxamide (PubChem CID 18084185) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-benzylfuran-2-carboxamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-benzylfuran-2-carboxamide |
|---|---|
| PubChem CID | 18084185 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-benzylfuran-2-carboxamide |
| SMILES | CCCCn1c(N)c(N(Cc2ccccc2)C(=O)c2ccco2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H22N4O4/c1-2-3-11-23-17(21)16(18(25)22-20(23)27)24(13-14-8-5-4-6-9-14)19(26)15-10-7-12-28-15/h4-10,12H,2-3,11,13,21H2,1H3,(H,22,25,27) |
| InChIKey | SZXXIIKIMFMLSW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |