C20H26N4O3 — CID 30659785
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-benzyl-3-methylbut-2-enamide (PubChem CID 30659785) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-benzyl-3-methylbut-2-enamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-benzyl-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 30659785 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-benzyl-3-methylbut-2-enamide |
| SMILES | CCCCn1c(N)c(N(Cc2ccccc2)C(=O)C=C(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H26N4O3/c1-4-5-11-23-18(21)17(19(26)22-20(23)27)24(16(25)12-14(2)3)13-15-9-7-6-8-10-15/h6-10,12H,4-5,11,13,21H2,1-3H3,(H,22,26,27) |
| InChIKey | RDTSZRPSOAAMRW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|