C20H28N4O3 — CID 55754269
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethyl-4-phenylbutanamide (PubChem CID 55754269) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethyl-4-phenylbutanamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethyl-4-phenylbutanamide |
|---|---|
| PubChem CID | 55754269 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethyl-4-phenylbutanamide |
| SMILES | CCCCn1c(N)c(N(CC)C(=O)CCCc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H28N4O3/c1-3-5-14-24-18(21)17(19(26)22-20(24)27)23(4-2)16(25)13-9-12-15-10-7-6-8-11-15/h6-8,10-11H,3-5,9,12-14,21H2,1-2H3,(H,22,26,27) |
| InChIKey | GSSWMRMHGWSBRM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |