C17H30N4O3 — CID 31491993
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butylpentanamide (PubChem CID 31491993) has the molecular formula C17H30N4O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butylpentanamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butylpentanamide |
|---|---|
| PubChem CID | 31491993 |
| Molecular Formula | C17H30N4O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-butylpentanamide |
| SMILES | CCCCC(=O)N(CCCC)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H30N4O3/c1-4-7-10-13(22)20(11-8-5-2)14-15(18)21(12-9-6-3)17(24)19-16(14)23/h4-12,18H2,1-3H3,(H,19,23,24) |
| InChIKey | PADICYSPECOQGO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |