C23H36N6O5 — CID 30971314
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-pentylpropanamide (PubChem CID 30971314) has the molecular formula C23H36N6O5 and a molecular weight of 476.58 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-pentylpropanamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-pentylpropanamide |
|---|---|
| PubChem CID | 30971314 |
| Molecular Formula | C23H36N6O5 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-pentylpropanamide |
| SMILES | CCCCCN(C(=O)CCN1C(=O)NC2(CCCC2)C1=O)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H36N6O5/c1-3-5-9-14-27(17-18(24)28(13-6-4-2)21(33)25-19(17)31)16(30)10-15-29-20(32)23(26-22(29)34)11-7-8-12-23/h3-15,24H2,1-2H3,(H,26,34)(H,25,31,33) |
| InChIKey | LOWLHTUGHJMUAA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 150.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|