C28H42N4O5 — CID 24818095
(4-tert-butylphenyl)methyl 4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-4-oxobutanoate (PubChem CID 24818095) has the molecular formula C28H42N4O5 and a molecular weight of 514.67 g/mol. Its IUPAC name is (4-tert-butylphenyl)methyl 4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-4-oxobutanoate.
| Compound Name | (4-tert-butylphenyl)methyl 4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 24818095 |
| Molecular Formula | C28H42N4O5 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.32 |
| IUPAC Name | (4-tert-butylphenyl)methyl 4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-4-oxobutanoate |
| SMILES | CCCCCN(C(=O)CCC(=O)OCc1ccc(C(C)(C)C)cc1)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C28H42N4O5/c1-6-8-10-18-31(24-25(29)32(17-9-7-2)27(36)30-26(24)35)22(33)15-16-23(34)37-19-20-11-13-21(14-12-20)28(3,4)5/h11-14H,6-10,15-19,29H2,1-5H3,(H,30,35,36) |
| InChIKey | MWFQLPQHMZYDJX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|