C23H37N5O6 — CID 42987795
[1-(cyclopropylamino)-1-oxopropan-2-yl] 4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-4-oxobutanoate (PubChem CID 42987795) has the molecular formula C23H37N5O6 and a molecular weight of 479.58 g/mol. Its IUPAC name is [1-(cyclopropylamino)-1-oxopropan-2-yl] 4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-4-oxobutanoate.
| Compound Name | [1-(cyclopropylamino)-1-oxopropan-2-yl] 4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 42987795 |
| Molecular Formula | C23H37N5O6 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | [1-(cyclopropylamino)-1-oxopropan-2-yl] 4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-4-oxobutanoate |
| SMILES | CCCCCN(C(=O)CCC(=O)OC(C)C(=O)NC1CC1)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H37N5O6/c1-4-6-8-14-27(19-20(24)28(13-7-5-2)23(33)26-22(19)32)17(29)11-12-18(30)34-15(3)21(31)25-16-9-10-16/h15-16H,4-14,24H2,1-3H3,(H,25,31)(H,26,32,33) |
| InChIKey | MEHAYHWSGGALTJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 156.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|