C24H34N4O5 — CID 42987801
benzyl 4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-4-oxobutanoate (PubChem CID 42987801) has the molecular formula C24H34N4O5 and a molecular weight of 458.56 g/mol. Its IUPAC name is benzyl 4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-4-oxobutanoate.
| Compound Name | benzyl 4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 42987801 |
| Molecular Formula | C24H34N4O5 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | benzyl 4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-4-oxobutanoate |
| SMILES | CCCCCN(C(=O)CCC(=O)OCc1ccccc1)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H34N4O5/c1-3-5-10-16-27(21-22(25)28(15-6-4-2)24(32)26-23(21)31)19(29)13-14-20(30)33-17-18-11-8-7-9-12-18/h7-9,11-12H,3-6,10,13-17,25H2,1-2H3,(H,26,31,32) |
| InChIKey | OGRXVMFYSSQPKK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|