C24H36N4O4 — CID 26205772
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-4-(4-methylphenoxy)-N-pentylbutanamide (PubChem CID 26205772) has the molecular formula C24H36N4O4 and a molecular weight of 444.58 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-4-(4-methylphenoxy)-N-pentylbutanamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-4-(4-methylphenoxy)-N-pentylbutanamide |
|---|---|
| PubChem CID | 26205772 |
| Molecular Formula | C24H36N4O4 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-4-(4-methylphenoxy)-N-pentylbutanamide |
| SMILES | CCCCCN(C(=O)CCCOc1ccc(C)cc1)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H36N4O4/c1-4-6-8-16-27(20(29)10-9-17-32-19-13-11-18(3)12-14-19)21-22(25)28(15-7-5-2)24(31)26-23(21)30/h11-14H,4-10,15-17,25H2,1-3H3,(H,26,30,31) |
| InChIKey | CYEFLYYHWDYMSL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|