C21H36N4O5 — CID 35539392
butyl 4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-4-oxobutanoate (PubChem CID 35539392) has the molecular formula C21H36N4O5 and a molecular weight of 424.54 g/mol. Its IUPAC name is butyl 4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-4-oxobutanoate.
| Compound Name | butyl 4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 35539392 |
| Molecular Formula | C21H36N4O5 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | butyl 4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-4-oxobutanoate |
| SMILES | CCCCCN(C(=O)CCC(=O)OCCCC)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H36N4O5/c1-4-7-10-14-24(16(26)11-12-17(27)30-15-9-6-3)18-19(22)25(13-8-5-2)21(29)23-20(18)28/h4-15,22H2,1-3H3,(H,23,28,29) |
| InChIKey | VSDZCSANQMXZSH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|