C24H33ClN4O5 — CID 29323013
[2-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-2-oxoethyl] 3-(2-chlorophenyl)propanoate (PubChem CID 29323013) has the molecular formula C24H33ClN4O5 and a molecular weight of 493.00 g/mol. Its IUPAC name is [2-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-2-oxoethyl] 3-(2-chlorophenyl)propanoate.
| Compound Name | [2-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-2-oxoethyl] 3-(2-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 29323013 |
| Molecular Formula | C24H33ClN4O5 |
| Molecular Weight | 493.00 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | [2-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-2-oxoethyl] 3-(2-chlorophenyl)propanoate |
| SMILES | CCCCCN(C(=O)COC(=O)CCc1ccccc1Cl)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H33ClN4O5/c1-3-5-9-15-28(21-22(26)29(14-6-4-2)24(33)27-23(21)32)19(30)16-34-20(31)13-12-17-10-7-8-11-18(17)25/h7-8,10-11H,3-6,9,12-16,26H2,1-2H3,(H,27,32,33) |
| InChIKey | UDSITCPJMIUVGQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.00 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|