C28H37N5O5 — CID 24978998
[2-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-2-oxoethyl] 2-(2,4-dimethylquinolin-3-yl)acetate (PubChem CID 24978998) has the molecular formula C28H37N5O5 and a molecular weight of 523.63 g/mol. Its IUPAC name is [2-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-2-oxoethyl] 2-(2,4-dimethylquinolin-3-yl)acetate.
| Compound Name | [2-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-2-oxoethyl] 2-(2,4-dimethylquinolin-3-yl)acetate |
|---|---|
| PubChem CID | 24978998 |
| Molecular Formula | C28H37N5O5 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | [2-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-2-oxoethyl] 2-(2,4-dimethylquinolin-3-yl)acetate |
| SMILES | CCCCCN(C(=O)COC(=O)Cc1c(C)nc2ccccc2c1C)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C28H37N5O5/c1-5-7-11-15-32(25-26(29)33(14-8-6-2)28(37)31-27(25)36)23(34)17-38-24(35)16-21-18(3)20-12-9-10-13-22(20)30-19(21)4/h9-10,12-13H,5-8,11,14-17,29H2,1-4H3,(H,31,36,37) |
| InChIKey | NBDFEQPWFAZEDD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 140.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|