C23H33N5O6 — CID 42987792
[2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-4-oxobutanoate (PubChem CID 42987792) has the molecular formula C23H33N5O6 and a molecular weight of 475.55 g/mol. Its IUPAC name is [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-4-oxobutanoate.
| Compound Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 42987792 |
| Molecular Formula | C23H33N5O6 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-4-oxobutanoate |
| SMILES | CCCCCN(C(=O)CCC(=O)OCC(=O)c1ccc[nH]1)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H33N5O6/c1-3-5-7-14-27(20-21(24)28(13-6-4-2)23(33)26-22(20)32)18(30)10-11-19(31)34-15-17(29)16-9-8-12-25-16/h8-9,12,25H,3-7,10-11,13-15,24H2,1-2H3,(H,26,32,33) |
| InChIKey | PXLKWDXNSXDMKH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 160.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|