C25H33N5O5 — CID 42987784
(2-cyanophenyl)methyl 4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-4-oxobutanoate (PubChem CID 42987784) has the molecular formula C25H33N5O5 and a molecular weight of 483.57 g/mol. Its IUPAC name is (2-cyanophenyl)methyl 4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-4-oxobutanoate.
| Compound Name | (2-cyanophenyl)methyl 4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 42987784 |
| Molecular Formula | C25H33N5O5 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | (2-cyanophenyl)methyl 4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-4-oxobutanoate |
| SMILES | CCCCCN(C(=O)CCC(=O)OCc1ccccc1C#N)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H33N5O5/c1-3-5-9-15-29(22-23(27)30(14-6-4-2)25(34)28-24(22)33)20(31)12-13-21(32)35-17-19-11-8-7-10-18(19)16-26/h7-8,10-11H,3-6,9,12-15,17,27H2,1-2H3,(H,28,33,34) |
| InChIKey | JVMQGFKYYKGRQQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 151.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|