C25H34N6O4 — CID 55413717
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-N-pentylpropanamide (PubChem CID 55413717) has the molecular formula C25H34N6O4 and a molecular weight of 482.59 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-N-pentylpropanamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-N-pentylpropanamide |
|---|---|
| PubChem CID | 55413717 |
| Molecular Formula | C25H34N6O4 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-N-pentylpropanamide |
| SMILES | CCCCCN(C(=O)CCc1nnc(-c2ccc(C)cc2)o1)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H34N6O4/c1-4-6-8-16-30(21-22(26)31(15-7-5-2)25(34)27-23(21)33)20(32)14-13-19-28-29-24(35-19)18-11-9-17(3)10-12-18/h9-12H,4-8,13-16,26H2,1-3H3,(H,27,33,34) |
| InChIKey | MHIXQIKZYDHGBX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|