C15H25N5O3S — CID 9093449
1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-cyclopropyl-1-(2-methoxyethyl)thiourea (PubChem CID 9093449) has the molecular formula C15H25N5O3S and a molecular weight of 355.46 g/mol. Its IUPAC name is 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-cyclopropyl-1-(2-methoxyethyl)thiourea.
| Compound Name | 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-cyclopropyl-1-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 9093449 |
| Molecular Formula | C15H25N5O3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-cyclopropyl-1-(2-methoxyethyl)thiourea |
| SMILES | CCCCn1c(N)c(N(CCOC)C(=S)NC2CC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H25N5O3S/c1-3-4-7-20-12(16)11(13(21)18-14(20)22)19(8-9-23-2)15(24)17-10-5-6-10/h10H,3-9,16H2,1-2H3,(H,17,24)(H,18,21,22) |
| InChIKey | TWIYPCCRCDHNHD-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 105.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|