C18H31N5O3S — CID 9095229
1-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-1-(2-methoxyethyl)-3-[(1S,2R)-2-methylcyclohexyl]thiourea (PubChem CID 9095229) has the molecular formula C18H31N5O3S and a molecular weight of 397.55 g/mol. Its IUPAC name is 1-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-1-(2-methoxyethyl)-3-[(1S,2R)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-1-(2-methoxyethyl)-3-[(1S,2R)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 9095229 |
| Molecular Formula | C18H31N5O3S |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 1-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-1-(2-methoxyethyl)-3-[(1S,2R)-2-methylcyclohexyl]thiourea |
| SMILES | CCCn1c(N)c(N(CCOC)C(=S)N[C@H]2CCCC[C@H]2C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H31N5O3S/c1-4-9-23-15(19)14(16(24)21-17(23)25)22(10-11-26-3)18(27)20-13-8-6-5-7-12(13)2/h12-13H,4-11,19H2,1-3H3,(H,20,27)(H,21,24,25)/t12-,13+/m1/s1 |
| InChIKey | ZOTZOMFCHMGCDN-OLZOCXBDSA-N |
| XLogP | 1.43 |
| TPSA | 105.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|