C20H35N5O2S — CID 9094118
1-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-1-butyl-3-[(1S,2S)-2-methylcyclohexyl]thiourea (PubChem CID 9094118) has the molecular formula C20H35N5O2S and a molecular weight of 409.60 g/mol. Its IUPAC name is 1-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-1-butyl-3-[(1S,2S)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-1-butyl-3-[(1S,2S)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 9094118 |
| Molecular Formula | C20H35N5O2S |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 1-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-1-butyl-3-[(1S,2S)-2-methylcyclohexyl]thiourea |
| SMILES | CCCCN(C(=S)N[C@H]1CCCC[C@@H]1C)c1c(N)n(CC(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H35N5O2S/c1-5-6-11-24(20(28)22-15-10-8-7-9-14(15)4)16-17(21)25(12-13(2)3)19(27)23-18(16)26/h13-15H,5-12,21H2,1-4H3,(H,22,28)(H,23,26,27)/t14-,15-/m0/s1 |
| InChIKey | NAXFYGKYIOTHOW-GJZGRUSLSA-N |
| XLogP | 2.83 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|