C14H25N5O4S — CID 9095201
1-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-1,3-bis(2-methoxyethyl)thiourea (PubChem CID 9095201) has the molecular formula C14H25N5O4S and a molecular weight of 359.45 g/mol. Its IUPAC name is 1-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-1,3-bis(2-methoxyethyl)thiourea.
| Compound Name | 1-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-1,3-bis(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 9095201 |
| Molecular Formula | C14H25N5O4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 1-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-1,3-bis(2-methoxyethyl)thiourea |
| SMILES | CCCn1c(N)c(N(CCOC)C(=S)NCCOC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H25N5O4S/c1-4-6-19-11(15)10(12(20)17-13(19)21)18(7-9-23-3)14(24)16-5-8-22-2/h4-9,15H2,1-3H3,(H,16,24)(H,17,20,21) |
| InChIKey | GXLGOAFXOAVXLN-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 114.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|