C15H27N5O2S — CID 9094343
1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-butyl-1-ethylthiourea (PubChem CID 9094343) has the molecular formula C15H27N5O2S and a molecular weight of 341.48 g/mol. Its IUPAC name is 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-butyl-1-ethylthiourea.
| Compound Name | 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-butyl-1-ethylthiourea |
|---|---|
| PubChem CID | 9094343 |
| Molecular Formula | C15H27N5O2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-butyl-1-ethylthiourea |
| SMILES | CCCCNC(=S)N(CC)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H27N5O2S/c1-4-7-9-17-15(23)19(6-3)11-12(16)20(10-8-5-2)14(22)18-13(11)21/h4-10,16H2,1-3H3,(H,17,23)(H,18,21,22) |
| InChIKey | BHAXMQSRQZNACJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|