C17H22FN5O2S — CID 9094357
1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-1-ethyl-3-(2-fluorophenyl)thiourea (PubChem CID 9094357) has the molecular formula C17H22FN5O2S and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-1-ethyl-3-(2-fluorophenyl)thiourea.
| Compound Name | 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-1-ethyl-3-(2-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 9094357 |
| Molecular Formula | C17H22FN5O2S |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-1-ethyl-3-(2-fluorophenyl)thiourea |
| SMILES | CCCCn1c(N)c(N(CC)C(=S)Nc2ccccc2F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H22FN5O2S/c1-3-5-10-23-14(19)13(15(24)21-16(23)25)22(4-2)17(26)20-12-9-7-6-8-11(12)18/h6-9H,3-5,10,19H2,1-2H3,(H,20,26)(H,21,24,25) |
| InChIKey | FBJKZYZUGVVJIU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|