C19H27N5O2S — CID 9093761
1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-1-benzyl-3-propan-2-ylthiourea (PubChem CID 9093761) has the molecular formula C19H27N5O2S and a molecular weight of 389.53 g/mol. Its IUPAC name is 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-1-benzyl-3-propan-2-ylthiourea.
| Compound Name | 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-1-benzyl-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 9093761 |
| Molecular Formula | C19H27N5O2S |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-1-benzyl-3-propan-2-ylthiourea |
| SMILES | CCCCn1c(N)c(N(Cc2ccccc2)C(=S)NC(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H27N5O2S/c1-4-5-11-23-16(20)15(17(25)22-18(23)26)24(19(27)21-13(2)3)12-14-9-7-6-8-10-14/h6-10,13H,4-5,11-12,20H2,1-3H3,(H,21,27)(H,22,25,26) |
| InChIKey | ZTDQGHAZSAEQQP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|