C17H29N5O4S — CID 9093448
1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-1-(2-methoxyethyl)-3-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 9093448) has the molecular formula C17H29N5O4S and a molecular weight of 399.52 g/mol. Its IUPAC name is 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-1-(2-methoxyethyl)-3-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-1-(2-methoxyethyl)-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 9093448 |
| Molecular Formula | C17H29N5O4S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-1-(2-methoxyethyl)-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | CCCCn1c(N)c(N(CCOC)C(=S)NC[C@H]2CCCO2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H29N5O4S/c1-3-4-7-22-14(18)13(15(23)20-16(22)24)21(8-10-25-2)17(27)19-11-12-6-5-9-26-12/h12H,3-11,18H2,1-2H3,(H,19,27)(H,20,23,24)/t12-/m1/s1 |
| InChIKey | CMFHOCACCALZTQ-GFCCVEGCSA-N |
| XLogP | 0.43 |
| TPSA | 114.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|