C21H36N4O5 — CID 55755448
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(3-methylbutyl)-3-(oxolan-2-ylmethoxy)propanamide (PubChem CID 55755448) has the molecular formula C21H36N4O5 and a molecular weight of 424.54 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(3-methylbutyl)-3-(oxolan-2-ylmethoxy)propanamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(3-methylbutyl)-3-(oxolan-2-ylmethoxy)propanamide |
|---|---|
| PubChem CID | 55755448 |
| Molecular Formula | C21H36N4O5 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(3-methylbutyl)-3-(oxolan-2-ylmethoxy)propanamide |
| SMILES | CCCCn1c(N)c(N(CCC(C)C)C(=O)CCOCC2CCCO2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H36N4O5/c1-4-5-10-25-19(22)18(20(27)23-21(25)28)24(11-8-15(2)3)17(26)9-13-29-14-16-7-6-12-30-16/h15-16H,4-14,22H2,1-3H3,(H,23,27,28) |
| InChIKey | QATFPNZJBBPKES-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 119.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|