C23H35N5O5 — CID 24816791
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(3-methylbutyl)acetamide (PubChem CID 24816791) has the molecular formula C23H35N5O5 and a molecular weight of 461.56 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(3-methylbutyl)acetamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(3-methylbutyl)acetamide |
|---|---|
| PubChem CID | 24816791 |
| Molecular Formula | C23H35N5O5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(3-methylbutyl)acetamide |
| SMILES | CCCCn1c(N)c(N(CCC(C)C)C(=O)CN2C(=O)C3CCCCC3C2=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H35N5O5/c1-4-5-11-27-19(24)18(20(30)25-23(27)33)26(12-10-14(2)3)17(29)13-28-21(31)15-8-6-7-9-16(15)22(28)32/h14-16H,4-13,24H2,1-3H3,(H,25,30,33) |
| InChIKey | RQYFIOVLFQKNQL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 138.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|