C22H29N5O6 — CID 55338175
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(2-methoxyethyl)acetamide (PubChem CID 55338175) has the molecular formula C22H29N5O6 and a molecular weight of 459.50 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(2-methoxyethyl)acetamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 55338175 |
| Molecular Formula | C22H29N5O6 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(2-methoxyethyl)acetamide |
| SMILES | CCCCn1c(N)c(N(CCOC)C(=O)CN2C(=O)C3C4C=CC(C4)C3C2=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H29N5O6/c1-3-4-7-26-18(23)17(19(29)24-22(26)32)25(8-9-33-2)14(28)11-27-20(30)15-12-5-6-13(10-12)16(15)21(27)31/h5-6,12-13,15-16H,3-4,7-11,23H2,1-2H3,(H,24,29,32) |
| InChIKey | UXJSHVSTKOKJDV-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 147.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|